CAS 466635-90-5 appears in our catalog under these names: (1R)-7-Chloro-1,2,3,4-tetrahydronaphthalen-1-ol, 95%, (1R)-7-Chloro-1,2,3,4-tetrahydronaphthalen-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1R)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 466635-90-5) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: (1R)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: IPHXZGPPFVUBEW-SNVBAGLBSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | (1R)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | IPHXZGPPFVUBEW-SNVBAGLBSA-N |
| SMILES | C1C[C@H](C2=C(C1)C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)