Products 1270505-34-4
CAS 1270505-34-4 is the registry number for 2-Amino-2-(3,5-dichlorophenyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-2-(3,5-dichlorophenyl)propanoic acid (CAS 1270505-34-4) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 2-amino-2-(3,5-dichlorophenyl)propanoic acid. InChIKey: IWMDICBGBPNXAH-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2-amino-2-(3,5-dichlorophenyl)propanoic acid |
| InChIKey | IWMDICBGBPNXAH-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)Cl)Cl)(C(=O)O)N |
Computed by PubChem (NCBI)