CAS 1270892-38-0 is the registry number for Ethyl 2-(7-bromo-2H-1,3-benzodioxol-5-yl)-2-hydroxyacetate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 2-(7-bromo-1,3-benzodioxol-5-yl)-2-hydroxyacetate (CAS 1270892-38-0) is a chemical compound with the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. IUPAC name: ethyl 2-(7-bromo-1,3-benzodioxol-5-yl)-2-hydroxyacetate. InChIKey: ULQJLZGTTJJJLV-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO5 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | ethyl 2-(7-bromo-1,3-benzodioxol-5-yl)-2-hydroxyacetate |
| InChIKey | ULQJLZGTTJJJLV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC2=C(C(=C1)Br)OCO2)O |
Computed by PubChem (NCBI)