Products 2666669-35-6
CAS 2666669-35-6 is the registry number for 3-(4-Bromo-2,5-dimethoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-2,5-dimethoxyphenyl)-2-oxopropanoic acid (CAS 2666669-35-6) is a chemical compound with the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. IUPAC name: 3-(4-bromo-2,5-dimethoxyphenyl)-2-oxopropanoic acid. InChIKey: MNZDIGPGFKMSMQ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO5 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | 3-(4-bromo-2,5-dimethoxyphenyl)-2-oxopropanoic acid |
| InChIKey | MNZDIGPGFKMSMQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1CC(=O)C(=O)O)OC)Br |
Computed by PubChem (NCBI)