CAS 676485-01-1 appears in our catalog under these names: Methyl 2-(2-bromo-4-formyl-6-methoxyphenoxy)acetate, 97%, Methyl (2-bromo-4-formyl-6-methoxyphenoxy)acetate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 2,5g.
Methyl 2-(2-bromo-4-formyl-6-methoxyphenoxy)acetate (CAS 676485-01-1) is a chemical compound with the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. IUPAC name: methyl 2-(2-bromo-4-formyl-6-methoxyphenoxy)acetate. InChIKey: ZHTBJCKPTFHJQE-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO5 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | methyl 2-(2-bromo-4-formyl-6-methoxyphenoxy)acetate |
| InChIKey | ZHTBJCKPTFHJQE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)Br)OCC(=O)OC |
Computed by PubChem (NCBI)