Products 2353733-99-8
CAS 2353733-99-8 is the registry number for 3-(4-Bromo-3,5-dimethoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-3,5-dimethoxyphenyl)-2-oxopropanoic acid (CAS 2353733-99-8) is a chemical compound with the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. IUPAC name: 3-(4-bromo-3,5-dimethoxyphenyl)-2-oxopropanoic acid. InChIKey: QICVCQOFBQZXPF-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO5 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | 3-(4-bromo-3,5-dimethoxyphenyl)-2-oxopropanoic acid |
| InChIKey | QICVCQOFBQZXPF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Br)OC)CC(=O)C(=O)O |
Computed by PubChem (NCBI)