Products 856095-63-1
CAS 856095-63-1 is the registry number for 3-(2-Bromo-4,5-dimethoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-bromo-4,5-dimethoxyphenyl)-2-oxopropanoic acid (CAS 856095-63-1) is a chemical compound with the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. IUPAC name: 3-(2-bromo-4,5-dimethoxyphenyl)-2-oxopropanoic acid. InChIKey: QLNPVUNBEBUUPM-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO5 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | 3-(2-bromo-4,5-dimethoxyphenyl)-2-oxopropanoic acid |
| InChIKey | QLNPVUNBEBUUPM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)C(=O)O)Br)OC |
Computed by PubChem (NCBI)