Products 1271093-64-1
CAS 1271093-64-1 appears in our catalog under these names: 1-(4-Chloro-2-cyanophenyl)-4-methylpiperidine-4-carboxylic acid, 1-(4-Chloro-2-cyanophenyl)-4-methylpiperidine-4-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
1-(4-chloro-2-cyanophenyl)-4-methylpiperidine-4-carboxylic acid (CAS 1271093-64-1) is a chemical compound with the molecular formula C14H15ClN2O2 and a molecular weight of 278.73 g/mol. IUPAC name: 1-(4-chloro-2-cyanophenyl)-4-methylpiperidine-4-carboxylic acid. InChIKey: QZCCRRUGFGJEHA-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2 |
|---|---|
| Molecular weight | 278.73 g/mol |
| IUPAC name | 1-(4-chloro-2-cyanophenyl)-4-methylpiperidine-4-carboxylic acid |
| InChIKey | QZCCRRUGFGJEHA-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C2=C(C=C(C=C2)Cl)C#N)C(=O)O |
Computed by PubChem (NCBI)