CAS 1272211-49-0 is the registry number for N-(2-Amino-4-methoxyphenyl)-4-thiazolecarboxamide. Offered by: TRC. Available pack sizes: 50mg.
N-(2-amino-4-methoxyphenyl)-1,3-thiazole-4-carboxamide (CAS 1272211-49-0) is a chemical compound with the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. IUPAC name: N-(2-amino-4-methoxyphenyl)-1,3-thiazole-4-carboxamide. InChIKey: ZCFDAEHZSIXXSH-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | N-(2-amino-4-methoxyphenyl)-1,3-thiazole-4-carboxamide |
| InChIKey | ZCFDAEHZSIXXSH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC(=O)C2=CSC=N2)N |
Computed by PubChem (NCBI)