CAS 127271-65-2 appears in our catalog under these names: 2-Fluoro-5-methoxybenzotrifluoride 97%, 2-Fluoro-5-methoxybenzotrifluoride, 97%, 2-Fluoro-5-methoxybenzotrifluoride, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g.
1-fluoro-4-methoxy-2-(trifluoromethyl)benzene (CAS 127271-65-2) is a chemical compound with the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. IUPAC name: 1-fluoro-4-methoxy-2-(trifluoromethyl)benzene. InChIKey: VUSCMOUYRPIURE-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | 1-fluoro-4-methoxy-2-(trifluoromethyl)benzene |
| InChIKey | VUSCMOUYRPIURE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)F)C(F)(F)F |
Computed by PubChem (NCBI)