Products 1272738-29-0
CAS 1272738-29-0 is the registry number for (R)-5,6-Difluoro-4-methoxy-2,3-dihydro-1H-inden-1-amine. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1R)-5,6-difluoro-4-methoxy-2,3-dihydro-1H-inden-1-amine (CAS 1272738-29-0) is a chemical compound with the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. IUPAC name: (1R)-5,6-difluoro-4-methoxy-2,3-dihydro-1H-inden-1-amine. InChIKey: RYYDWHPMMLCMGW-MRVPVSSYSA-N.
| Molecular formula | C10H11F2NO |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | (1R)-5,6-difluoro-4-methoxy-2,3-dihydro-1H-inden-1-amine |
| InChIKey | RYYDWHPMMLCMGW-MRVPVSSYSA-N |
| SMILES | COC1=C2CC[C@H](C2=CC(=C1F)F)N |
Computed by PubChem (NCBI)