Products 1273609-10-1
CAS 1273609-10-1 is the registry number for 5-Bromo-7-Hydroxy-2,3-Dihydro-1H-Inden-1-One, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-7-hydroxy-2,3-dihydroinden-1-one (CAS 1273609-10-1) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 5-bromo-7-hydroxy-2,3-dihydroinden-1-one. InChIKey: LNXMMFUIYGACKL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 5-bromo-7-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | LNXMMFUIYGACKL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2O)Br |
Computed by PubChem (NCBI)