Products 1273655-08-5
CAS 1273655-08-5 is the registry number for 7-(Trifluoromethyl)-2,3-dihydrobenzofuran-3-amine, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
7-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-amine (CAS 1273655-08-5) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: 7-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-amine. InChIKey: YTCQULZGKIRBTI-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 7-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | YTCQULZGKIRBTI-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)