CAS 1273704-74-7 is the registry number for 4-{(2-(Pyridin-2-yl)ethyl)amino}benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(2-pyridin-2-ylethylamino)benzoic acid (CAS 1273704-74-7) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: 4-(2-pyridin-2-ylethylamino)benzoic acid. InChIKey: ZERPSBYNMZTSBZ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 4-(2-pyridin-2-ylethylamino)benzoic acid |
| InChIKey | ZERPSBYNMZTSBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CCNC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)