CAS 1273946-12-5 is the registry number for 6-(4,5-Dimethyl-2-thiazolyl)aminonicotinic Acid. Offered by: TRC. Available pack sizes: 1g.
6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyridine-3-carboxylic acid (CAS 1273946-12-5) is a chemical compound with the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. IUPAC name: 6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyridine-3-carboxylic acid. InChIKey: CUUBFDFOIBKCTB-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyridine-3-carboxylic acid |
| InChIKey | CUUBFDFOIBKCTB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC2=NC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)