Products 127420-24-0
CAS 127420-24-0 is the registry number for Idrapril. Offered by: MedChemExpress. Available pack sizes: Get quote.
Cis-(1S,2R)-2-[[2-(hydroxyamino)-2-oxoethyl]-methylcarbamoyl]cyclohexane-1-carboxylic acid (CAS 127420-24-0) is a chemical compound with the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. IUPAC name: cis-(1S,2R)-2-[[2-(hydroxyamino)-2-oxoethyl]-methylcarbamoyl]cyclohexane-1-carboxylic acid. InChIKey: QKIVRALZQSUWHH-SFYZADRCSA-N.
| Molecular formula | C11H18N2O5 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | cis-(1S,2R)-2-[[2-(hydroxyamino)-2-oxoethyl]-methylcarbamoyl]cyclohexane-1-carboxylic acid |
| InChIKey | QKIVRALZQSUWHH-SFYZADRCSA-N |
| SMILES | CN(CC(=O)NO)C(=O)[C@@H]1CCCC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)