Products 1274611-43-6
CAS 1274611-43-6 appears in our catalog under these names: Antibacterial agent 125/ 98.81% (existing batch purity), Antibacterial agent 125, Antibacterial agent 125, 98.90%, 3-Chloro-N-(4-cyanophenyl)benzeneacetamide. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg, 10 mg.
2-(3-chlorophenyl)-N-(4-cyanophenyl)acetamide (CAS 1274611-43-6) is a chemical compound with the molecular formula C15H11ClN2O and a molecular weight of 270.71 g/mol. IUPAC name: 2-(3-chlorophenyl)-N-(4-cyanophenyl)acetamide. InChIKey: QUFHIWLHKLGWNH-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-N-(4-cyanophenyl)acetamide |
| InChIKey | QUFHIWLHKLGWNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC(=O)NC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)