Products 127472-41-7
CAS 127472-41-7 appears in our catalog under these names: 1-Ethyl-1h-indazole-3-carboxylic acid, 95%, 1–Ethyl–1H–indazole–3–carboxylic acid, 1-Ethyl-1H-indazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
1-ethylindazole-3-carboxylic acid (CAS 127472-41-7) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 1-ethylindazole-3-carboxylic acid. InChIKey: SLNCETLOKNMOBN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1-ethylindazole-3-carboxylic acid |
| InChIKey | SLNCETLOKNMOBN-UHFFFAOYSA-N |
| SMILES | CCN1C2=CC=CC=C2C(=N1)C(=O)O |
Computed by PubChem (NCBI)