CAS 127532-47-2 is the registry number for 2,2,2-Trifluoro-1-(2-methylindolizin-3-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2,2-trifluoro-1-(2-methylindolizin-3-yl)ethanone (CAS 127532-47-2) is a chemical compound with the molecular formula C11H8F3NO and a molecular weight of 227.18 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-methylindolizin-3-yl)ethanone. InChIKey: BQBFZNVCQSRADE-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-methylindolizin-3-yl)ethanone |
| InChIKey | BQBFZNVCQSRADE-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=CC=CC2=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)