Products 1275532-56-3

CAS 1275532-56-3 is the registry number for 3-Bromo-2-ethoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-2-ethoxybenzoic acid (CAS 1275532-56-3) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 3-bromo-2-ethoxybenzoic acid. InChIKey: BYAFUEVISDSIDD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrO3
Molecular weight245.07 g/mol
IUPAC name3-bromo-2-ethoxybenzoic acid
InChIKeyBYAFUEVISDSIDD-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC=C1Br)C(=O)O

Computed by PubChem (NCBI)