Products 1275608-16-6
CAS 1275608-16-6 is the registry number for 6-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-ethyl-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione (CAS 1275608-16-6) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 6-ethyl-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione. InChIKey: AWGHQWHJMGAYEE-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 6-ethyl-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione |
| InChIKey | AWGHQWHJMGAYEE-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(N1)NC(=O)NC2=O |
Computed by PubChem (NCBI)