Products 1276197-22-8
CAS 1276197-22-8 appears in our catalog under these names: rac Mono(ethylhexyl) Phthalate-D4, >95% (HPLC), rac Mono(ethylhexyl) phthalate-d4, Mono-(2-ethylhexyl) phthalate-d4, 99.71%, D4-Mono-2-ethylhexyl phthalate, D4-Mono-2-ethylhexyl phthalate, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Biosynth, MedChemExpress, HPC Standards. Available pack sizes: 2,5mg, 25mg, 10mg, 1mg, 2mg, 5mg, 10 mg, 1x10mg.
2,3,4,5-tetradeuterio-6-(2-ethylhexoxycarbonyl)benzoic acid (CAS 1276197-22-8) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 282.37 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(2-ethylhexoxycarbonyl)benzoic acid. InChIKey: DJDSLBVSSOQSLW-NECLWFIRSA-N.
| Molecular formula | C16H22O4 |
|---|---|
| Molecular weight | 282.37 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(2-ethylhexoxycarbonyl)benzoic acid |
| InChIKey | DJDSLBVSSOQSLW-NECLWFIRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC(CC)CCCC)[2H])[2H] |
Computed by PubChem (NCBI)