CAS 1276732-89-8 appears in our catalog under these names: Carbidopa-d3, Carbidopa-d3, 99.76%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1 mg, 5 mg.
(2S)-2-hydrazinyl-2-methyl-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoic acid (CAS 1276732-89-8) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 229.25 g/mol. IUPAC name: (2S)-2-hydrazinyl-2-methyl-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoic acid. InChIKey: TZFNLOMSOLWIDK-RPACEKEXSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 229.25 g/mol |
| IUPAC name | (2S)-2-hydrazinyl-2-methyl-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoic acid |
| InChIKey | TZFNLOMSOLWIDK-RPACEKEXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C[C@@](C)(C(=O)O)NN)[2H])O)O)[2H] |
Computed by PubChem (NCBI)