CAS 28875-92-5 appears in our catalog under these names: (R)-Carbidopa, R-Carbidopa, R-(+)-Carbidopa, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg, 5mg.
(2R)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid (CAS 28875-92-5) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: (2R)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid. InChIKey: TZFNLOMSOLWIDK-SNVBAGLBSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | (2R)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
| InChIKey | TZFNLOMSOLWIDK-SNVBAGLBSA-N |
| SMILES | C[C@@](CC1=CC(=C(C=C1)O)O)(C(=O)O)NN |
Computed by PubChem (NCBI)