Products 1277188-85-8
CAS 1277188-85-8 appears in our catalog under these names: 5,7–Dimethoxyflavanone, (2R)-5,7-Dimethoxyflavanone, (R)-5,7-Dimethoxyflavanone, 99%, 99%, (R)-5,7-Dimethoxyflavanone, 99.98%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
(2R)-5,7-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one (CAS 1277188-85-8) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: (2R)-5,7-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one. InChIKey: IAFBOKYTDSDNHV-CQSZACIVSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (2R)-5,7-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one |
| InChIKey | IAFBOKYTDSDNHV-CQSZACIVSA-N |
| SMILES | COC1=CC2=C(C(=O)C[C@@H](O2)C3=CC=CC=C3)C(=C1)OC |
Computed by PubChem (NCBI)