CAS 12772-83-7 is the registry number for Dupracine. Offered by: TRC. Available pack sizes: 5g.
(E)-3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)prop-2-enoic acid (CAS 12772-83-7) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: (E)-3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)prop-2-enoic acid. InChIKey: CRUHYIAGEXBWKH-GQCTYLIASA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | (E)-3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)prop-2-enoic acid |
| InChIKey | CRUHYIAGEXBWKH-GQCTYLIASA-N |
| SMILES | CC1(CCC2=C(O1)C=CC(=C2)/C=C/C(=O)O)C |
Computed by PubChem (NCBI)