CAS 2311-91-3 is the registry number for Monoperoxyphthalic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-carbonoperoxoylbenzoic acid (CAS 2311-91-3) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 2-carbonoperoxoylbenzoic acid. InChIKey: GLVYLTSKTCWWJR-UHFFFAOYSA-N.
| Molecular formula | C8H6O5 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-carbonoperoxoylbenzoic acid |
| InChIKey | GLVYLTSKTCWWJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)OO |
Computed by PubChem (NCBI)