Products 63024-01-1
CAS 63024-01-1 appears in our catalog under these names: (S)-Benzyl 2-amino-3-(benzyloxy)propanoate hydrochloride, 98%, 98%, H-Ser(Bzl)-OBzl·HCl, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Benzyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride (CAS 63024-01-1) is a chemical compound with the molecular formula C17H20ClNO3 and a molecular weight of 321.8 g/mol. IUPAC name: benzyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride. InChIKey: BGAVLJMLSSCOSD-NTISSMGPSA-N.
| Molecular formula | C17H20ClNO3 |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride |
| InChIKey | BGAVLJMLSSCOSD-NTISSMGPSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H](C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-Benzyl 2-amino-3-(benzyloxy)propanoate hydrochloride, H-Ser(Bzl)-OBzlHCl, benzyl (2S)-2-amino-3-(benzyloxy)propanoate hydrochloride, O-benzyl-l-serine benzyl ester hydrochloride, benzyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride, starbld0017279, H-Ser(Bzl)-OBzl.HCl, O-Benzyl L-serine benzyl ester HCl, benzyl O-benzyl-L-serinate hydrochloride, O-Benzyl L-serine benzyl ester hydrochloride