CAS 1279123-46-4 is the registry number for 2-Cyclobutyl-1,3-benzothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-cyclobutyl-1,3-benzothiazole (CAS 1279123-46-4) is a chemical compound with the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. IUPAC name: 2-cyclobutyl-1,3-benzothiazole. InChIKey: SDVSGZYYDRMSJJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NS |
|---|---|
| Molecular weight | 189.28 g/mol |
| IUPAC name | 2-cyclobutyl-1,3-benzothiazole |
| InChIKey | SDVSGZYYDRMSJJ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)