CAS 19968-59-3 is the registry number for 2,5-Dimethyl-4-phenylthiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
2,5-dimethyl-4-phenyl-1,3-thiazole (CAS 19968-59-3) is a chemical compound with the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. IUPAC name: 2,5-dimethyl-4-phenyl-1,3-thiazole. InChIKey: MSTZWWAYEIGOJI-UHFFFAOYSA-N.
| Molecular formula | C11H11NS |
|---|---|
| Molecular weight | 189.28 g/mol |
| IUPAC name | 2,5-dimethyl-4-phenyl-1,3-thiazole |
| InChIKey | MSTZWWAYEIGOJI-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)