CAS 64215-48-1 appears in our catalog under these names: 4,7-Dimethylquinoline-2-thiol, 95%, 4,7-Dimethylquinoline-2-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
4,7-dimethyl-1H-quinoline-2-thione (CAS 64215-48-1) is a chemical compound with the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. IUPAC name: 4,7-dimethyl-1H-quinoline-2-thione. InChIKey: VBWHJNKSSZEICG-UHFFFAOYSA-N.
| Molecular formula | C11H11NS |
|---|---|
| Molecular weight | 189.28 g/mol |
| IUPAC name | 4,7-dimethyl-1H-quinoline-2-thione |
| InChIKey | VBWHJNKSSZEICG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CC(=S)N2)C |
Computed by PubChem (NCBI)