CAS 5693-42-5 appears in our catalog under these names: 1-Phenyl-1-thien-2-ylmethanamine, 95%, Phenyl(thiophen-2-yl)methanamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 5g.
Phenyl(thiophen-2-yl)methanamine (CAS 5693-42-5) is a chemical compound with the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. IUPAC name: phenyl(thiophen-2-yl)methanamine. InChIKey: MUAFFFYJFXPGHN-UHFFFAOYSA-N.
| Molecular formula | C11H11NS |
|---|---|
| Molecular weight | 189.28 g/mol |
| IUPAC name | phenyl(thiophen-2-yl)methanamine |
| InChIKey | MUAFFFYJFXPGHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CS2)N |
Computed by PubChem (NCBI)