CAS 203436-48-0 appears in our catalog under these names: 4-(2-Thienyl)benzylamine, 95%, (4-(Thiophen-2-yl)phenyl)methanamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
(4-thiophen-2-ylphenyl)methanamine (CAS 203436-48-0) is a chemical compound with the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. IUPAC name: (4-thiophen-2-ylphenyl)methanamine. InChIKey: YKNLMMDEWQZCLJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NS |
|---|---|
| Molecular weight | 189.28 g/mol |
| IUPAC name | (4-thiophen-2-ylphenyl)methanamine |
| InChIKey | YKNLMMDEWQZCLJ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)