CAS 1279200-05-3 is the registry number for 4–Benzyloxycarbonylamino–pyrrolidine–2–carboxylic acid methyl ester. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Methyl (2R,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylate (CAS 1279200-05-3) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: methyl (2R,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylate. InChIKey: MDYGFJHMKWJTTE-NWDGAFQWSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | methyl (2R,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylate |
| InChIKey | MDYGFJHMKWJTTE-NWDGAFQWSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H](CN1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)