CAS 1279213-03-4 appears in our catalog under these names: 5-Chloro-6-methylpyridine-2-sulfonyl chloride, 95%, 5-Chloro-6-methylpyridine-2-sulfonyl Chloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
5-chloro-6-methylpyridine-2-sulfonyl chloride (CAS 1279213-03-4) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 5-chloro-6-methylpyridine-2-sulfonyl chloride. InChIKey: LQWMAVRNJCDLRU-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 5-chloro-6-methylpyridine-2-sulfonyl chloride |
| InChIKey | LQWMAVRNJCDLRU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)