Products 1279820-89-1
CAS 1279820-89-1 is the registry number for 2-chloro-3-(1,3-dioxolan-2-yl)-6-(trifluoromethyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-chloro-3-(1,3-dioxolan-2-yl)-6-(trifluoromethyl)pyridine (CAS 1279820-89-1) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: 2-chloro-3-(1,3-dioxolan-2-yl)-6-(trifluoromethyl)pyridine. InChIKey: WNNDIUYDQDRJNT-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO2 |
|---|---|
| Molecular weight | 253.60 g/mol |
| IUPAC name | 2-chloro-3-(1,3-dioxolan-2-yl)-6-(trifluoromethyl)pyridine |
| InChIKey | WNNDIUYDQDRJNT-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(N=C(C=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)