Products 1279872-89-7
CAS 1279872-89-7 appears in our catalog under these names: 7-(Phenylsulfonyl)-7h-pyrrolo[2,3-d]pyrimidine, 95%, 7-(Phenylsulfonyl)-7H-Pyrrolo(2,3-d)pyrimidine, 97%, 7-(Phenylsulfonyl)-7H-Pyrrolo[2,3-d]pyrimidine, 97%, 97%, 7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g.
7-(benzenesulfonyl)pyrrolo[2,3-d]pyrimidine (CAS 1279872-89-7) is a chemical compound with the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. IUPAC name: 7-(benzenesulfonyl)pyrrolo[2,3-d]pyrimidine. InChIKey: KRDVTTFTHMIQDI-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2S |
|---|---|
| Molecular weight | 259.29 g/mol |
| IUPAC name | 7-(benzenesulfonyl)pyrrolo[2,3-d]pyrimidine |
| InChIKey | KRDVTTFTHMIQDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CN=CN=C32 |
Computed by PubChem (NCBI)