CAS 216507-85-6 is the registry number for 3-Phenyl-4H-1λâ¶-pyrido(2,3-E)(1,2,4)thiadiazine-1,1-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-phenyl-4H-pyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide (CAS 216507-85-6) is a chemical compound with the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. IUPAC name: 3-phenyl-4H-pyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide. InChIKey: NEQNVSVRPNWIPU-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2S |
|---|---|
| Molecular weight | 259.29 g/mol |
| IUPAC name | 3-phenyl-4H-pyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide |
| InChIKey | NEQNVSVRPNWIPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NS(=O)(=O)C3=C(N2)N=CC=C3 |
Computed by PubChem (NCBI)