CAS 70638-54-9 is the registry number for 4-(4-Methoxyphenyl)-6-oxo-2-sulfanyl-1,6-dihydropyrimidine-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile (CAS 70638-54-9) is a chemical compound with the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. IUPAC name: 6-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile. InChIKey: PXEWDUZAXRERFW-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2S |
|---|---|
| Molecular weight | 259.29 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| InChIKey | PXEWDUZAXRERFW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)NC(=S)N2)C#N |
Computed by PubChem (NCBI)