CAS 91494-10-9 is the registry number for 2-[(2-Amino-1,3-thiazol-4-yl)methyl]-1h-isoindole-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(2-amino-1,3-thiazol-4-yl)methyl]isoindole-1,3-dione (CAS 91494-10-9) is a chemical compound with the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. IUPAC name: 2-[(2-amino-1,3-thiazol-4-yl)methyl]isoindole-1,3-dione. InChIKey: NYPGGDKQGRZEHU-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2S |
|---|---|
| Molecular weight | 259.29 g/mol |
| IUPAC name | 2-[(2-amino-1,3-thiazol-4-yl)methyl]isoindole-1,3-dione |
| InChIKey | NYPGGDKQGRZEHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CSC(=N3)N |
Computed by PubChem (NCBI)