CAS 681170-14-9 is the registry number for N-(5-Methylisoxazol-3-yl)benzo[d]thiazole-6-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-methyl-1,2-oxazol-3-yl)-1,3-benzothiazole-6-carboxamide (CAS 681170-14-9) is a chemical compound with the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. IUPAC name: N-(5-methyl-1,2-oxazol-3-yl)-1,3-benzothiazole-6-carboxamide. InChIKey: RQHVNTGBUYDNLI-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2S |
|---|---|
| Molecular weight | 259.29 g/mol |
| IUPAC name | N-(5-methyl-1,2-oxazol-3-yl)-1,3-benzothiazole-6-carboxamide |
| InChIKey | RQHVNTGBUYDNLI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC(=O)C2=CC3=C(C=C2)N=CS3 |
Computed by PubChem (NCBI)