Products 128073-49-4

CAS 128073-49-4 is the registry number for 2-tert-Butyl 1-ethyl 6-hydroxy-3,4-dihydroisoquinoline-1,2(1H)-dicarboxylate, 90%, 90%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 1-O-ethyl 6-hydroxy-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate (CAS 128073-49-4) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: 2-O-tert-butyl 1-O-ethyl 6-hydroxy-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate. InChIKey: HOPREPHTFMBXEI-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23NO5
Molecular weight321.4 g/mol
IUPAC name2-O-tert-butyl 1-O-ethyl 6-hydroxy-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate
InChIKeyHOPREPHTFMBXEI-UHFFFAOYSA-N
SMILESCCOC(=O)C1C2=C(CCN1C(=O)OC(C)(C)C)C=C(C=C2)O

Computed by PubChem (NCBI)