CAS 128090-87-9 appears in our catalog under these names: L-Valyl-L-phenylalanine hydrochloride, 98%, L-Valyl-L-phenylalanine HCl, 2-(2-Amino-3-methylbutanamido)-3-phenylpropanoic acid hydrochloride, 2-(2-Amino-3-methylbutanamido)-3-phenylpropanoic acid hydrochloride, 95%. Offered by: AmBeed, TargetMol, Biosynth, Chemat, Fluorochem. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 0,5g.
2-[(2-amino-3-methylbutanoyl)amino]-3-phenylpropanoic acid;hydrochloride (CAS 128090-87-9) is a chemical compound with the molecular formula C14H21ClN2O3 and a molecular weight of 300.78 g/mol. IUPAC name: 2-[(2-amino-3-methylbutanoyl)amino]-3-phenylpropanoic acid;hydrochloride. InChIKey: COJUZXNEOMXFFV-UHFFFAOYSA-N.
| Molecular formula | C14H21ClN2O3 |
|---|---|
| Molecular weight | 300.78 g/mol |
| IUPAC name | 2-[(2-amino-3-methylbutanoyl)amino]-3-phenylpropanoic acid;hydrochloride |
| InChIKey | COJUZXNEOMXFFV-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)NC(CC1=CC=CC=C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)