CAS 1281165-58-9 is the registry number for 5-(N,N-Dimethylsulfamoyl)-N-methylfuran-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(dimethylsulfamoyl)-N-methylfuran-2-carboxamide (CAS 1281165-58-9) is a chemical compound with the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. IUPAC name: 5-(dimethylsulfamoyl)-N-methylfuran-2-carboxamide. InChIKey: CPCFOGDZQNGWNN-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O4S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 5-(dimethylsulfamoyl)-N-methylfuran-2-carboxamide |
| InChIKey | CPCFOGDZQNGWNN-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=C(O1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)