Products 1343878-73-8

CAS 1343878-73-8 is the registry number for 1-(3-(Methylsulfonyl)propyl)-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(3-methylsulfonylpropyl)pyrazole-3-carboxylic acid (CAS 1343878-73-8) is a chemical compound with the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. IUPAC name: 2-(3-methylsulfonylpropyl)pyrazole-3-carboxylic acid. InChIKey: ALEBGKWMPPHIHY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O4S
Molecular weight232.26 g/mol
IUPAC name2-(3-methylsulfonylpropyl)pyrazole-3-carboxylic acid
InChIKeyALEBGKWMPPHIHY-UHFFFAOYSA-N
SMILESCS(=O)(=O)CCCN1C(=CC=N1)C(=O)O

Computed by PubChem (NCBI)