CAS 70605-67-3 appears in our catalog under these names: Pidotimod Impurity 28, ((S)-Oxopyrrolidine-2-carbonyl)-L-cysteine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2R)-2-[[(2S)-3-oxopyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoic acid (CAS 70605-67-3) is a chemical compound with the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. IUPAC name: (2R)-2-[[(2S)-3-oxopyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoic acid. InChIKey: PVNAIPPDNKDJLU-NJGYIYPDSA-N.
| Molecular formula | C8H12N2O4S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | (2R)-2-[[(2S)-3-oxopyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoic acid |
| InChIKey | PVNAIPPDNKDJLU-NJGYIYPDSA-N |
| SMILES | C1CN[C@@H](C1=O)C(=O)N[C@@H](CS)C(=O)O |
Computed by PubChem (NCBI)