Products 73737-06-1
CAS 73737-06-1 appears in our catalog under these names: 2,4-Dimethoxybenzenesulfonohydrazide, 95%, 2,4-Dimethoxybenzenesulfonohydrazide, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 50mg, 100mg.
2,4-dimethoxybenzenesulfonohydrazide (CAS 73737-06-1) is a chemical compound with the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. IUPAC name: 2,4-dimethoxybenzenesulfonohydrazide. InChIKey: ATIQRHKUIYAQID-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O4S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 2,4-dimethoxybenzenesulfonohydrazide |
| InChIKey | ATIQRHKUIYAQID-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)S(=O)(=O)NN)OC |
Computed by PubChem (NCBI)