CAS 871548-26-4 appears in our catalog under these names: 3-(3,5-Dimethyl-1,1-dioxo-1,2-dihydro-1lambda6-[1,2,6]thiadiazin-4-yl)-propionic acid, 95%, 3-(3,5-Dimethyl-1,1-dioxido-2H-1,2,6-thiadiazin-4-yl)propanoic acid, 95+%, 3-(3,5-Dimethyl-1,1-dioxo-2H-1,2,6-thiadiazin-4-yl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 0,5g.
3-(3,5-dimethyl-1,1-dioxo-2H-1,2,6-thiadiazin-4-yl)propanoic acid (CAS 871548-26-4) is a chemical compound with the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. IUPAC name: 3-(3,5-dimethyl-1,1-dioxo-2H-1,2,6-thiadiazin-4-yl)propanoic acid. InChIKey: HPWIJDMLPLRDLN-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O4S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 3-(3,5-dimethyl-1,1-dioxo-2H-1,2,6-thiadiazin-4-yl)propanoic acid |
| InChIKey | HPWIJDMLPLRDLN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NS(=O)(=O)N1)C)CCC(=O)O |
Computed by PubChem (NCBI)