CAS 128241-59-8 appears in our catalog under these names: Quinine Impurity 1, (3R)-3-Hydroxy Quinine. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
(3R,4S,6S)-3-ethenyl-6-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-ol (CAS 128241-59-8) is a chemical compound with the molecular formula C20H24N2O3 and a molecular weight of 340.4 g/mol. IUPAC name: (3R,4S,6S)-3-ethenyl-6-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-ol. InChIKey: BSRUJCFCZKMFMB-JZOCTASASA-N.
| Molecular formula | C20H24N2O3 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (3R,4S,6S)-3-ethenyl-6-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-ol |
| InChIKey | BSRUJCFCZKMFMB-JZOCTASASA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@H]([C@@H]3C[C@@H]4CCN3C[C@]4(C=C)O)O |
Computed by PubChem (NCBI)