Products 53467-23-5
CAS 53467-23-5 appears in our catalog under these names: (3S)-3-Hydroxy Quinidine, Quinine Impurity 3, (3S)-3-Hydroxy Quinidine, >95% (HPLC), (3S)-hydroxy Quinidine, (3S)–hydroxy Quinidine. Offered by: Chemat Brand, Hubei YoungXin, TRC, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 500ug.
(3S,4S,6R)-3-ethenyl-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-ol (CAS 53467-23-5) is a chemical compound with the molecular formula C20H24N2O3 and a molecular weight of 340.4 g/mol. IUPAC name: (3S,4S,6R)-3-ethenyl-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-ol. InChIKey: BSRUJCFCZKMFMB-LGWHJFRWSA-N.
| Molecular formula | C20H24N2O3 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (3S,4S,6R)-3-ethenyl-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-ol |
| InChIKey | BSRUJCFCZKMFMB-LGWHJFRWSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@@H]([C@H]3C[C@@H]4CCN3C[C@@]4(C=C)O)O |
Computed by PubChem (NCBI)